C20H30O — CID 87891406
3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-1,3,5,7-tetraen-5-ol (PubChem CID 87891406) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is 3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-1,3,5,7-tetraen-5-ol.
| Compound Name | 3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-1,3,5,7-tetraen-5-ol |
|---|---|
| PubChem CID | 87891406 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 3,7-dimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)nona-1,3,5,7-tetraen-5-ol |
| SMILES | CC=C(C)C=C(O)C=C(C)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C20H30O/c1-7-15(2)13-18(21)14-16(3)10-11-19-17(4)9-8-12-20(19,5)6/h7,10-11,13-14,21H,8-9,12H2,1-6H3 |
| InChIKey | QILVJNQDGIXWKZ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|