C14H24N4 — CID 92533713
2-[(E)-[(Z)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylidene]amino]guanidine (PubChem CID 92533713) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-[(E)-[(Z)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylidene]amino]guanidine.
| Compound Name | 2-[(E)-[(Z)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylidene]amino]guanidine |
|---|---|
| PubChem CID | 92533713 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 2-[(E)-[(Z)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylidene]amino]guanidine |
| SMILES | CC1=C(/C=C\C(C)=N\N=C(N)N)C(C)(C)CCC1 |
| InChI | InChI=1S/C14H24N4/c1-10-6-5-9-14(3,4)12(10)8-7-11(2)17-18-13(15)16/h7-8H,5-6,9H2,1-4H3,(H4,15,16,18)/b8-7-,17-11+ |
| InChIKey | ZEWDNOFNNKZKDB-IOERDVGBSA-N |
| XLogP | 2.72 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|