C16H23NO — CID 10681820
(E,E)-N-prop-2-ynoxy-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-imine (PubChem CID 10681820) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (E,E)-N-prop-2-ynoxy-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-imine.
| Compound Name | (E,E)-N-prop-2-ynoxy-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-imine |
|---|---|
| PubChem CID | 10681820 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (E,E)-N-prop-2-ynoxy-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-imine |
| SMILES | C#CCO/N=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C16H23NO/c1-6-12-18-17-14(3)9-10-15-13(2)8-7-11-16(15,4)5/h1,9-10H,7-8,11-12H2,2-5H3/b10-9+,17-14+ |
| InChIKey | XAACQLXKLRXJIR-XYJQQDCNSA-N |
| XLogP | 4.09 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|