C16H24O — CID 98565733
(Z,3R)-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)hex-1-en-5-yn-3-ol (PubChem CID 98565733) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is (Z,3R)-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)hex-1-en-5-yn-3-ol.
| Compound Name | (Z,3R)-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)hex-1-en-5-yn-3-ol |
|---|---|
| PubChem CID | 98565733 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | (Z,3R)-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)hex-1-en-5-yn-3-ol |
| SMILES | C#CC[C@@](C)(O)/C=C\C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C16H24O/c1-6-10-16(5,17)12-9-14-13(2)8-7-11-15(14,3)4/h1,9,12,17H,7-8,10-11H2,2-5H3/b12-9-/t16-/m1/s1 |
| InChIKey | OISIVHUKVJCYEN-HMWXGYMHSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|