C26H40O2 — CID 77238031
4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one (PubChem CID 77238031) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is 4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one.
| Compound Name | 4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 77238031 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one |
| SMILES | CC(=O)C=CC1=C(C)CCCC1(C)C.CC(=O)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/2C13H20O/c2*1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h2*7-8H,5-6,9H2,1-4H3 |
| InChIKey | IQPGMONESRXFRU-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|