C14H23NO2 — CID 10561866
(E)-N-methoxy-N-methyl-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enamide (PubChem CID 10561866) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is (E)-N-methoxy-N-methyl-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enamide.
| Compound Name | (E)-N-methoxy-N-methyl-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 10561866 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | (E)-N-methoxy-N-methyl-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enamide |
| SMILES | CON(C)C(=O)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C14H23NO2/c1-11-7-6-10-14(2,3)12(11)8-9-13(16)15(4)17-5/h8-9H,6-7,10H2,1-5H3/b9-8+ |
| InChIKey | VRNHBFRZWYVYKC-CMDGGOBGSA-N |
| XLogP | 3.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|