C12H18O2 — CID 5383969
(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoic acid (PubChem CID 5383969) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 5383969 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoic acid |
| SMILES | CC1=C(/C=C/C(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C12H18O2/c1-9-5-4-8-12(2,3)10(9)6-7-11(13)14/h6-7H,4-5,8H2,1-3H3,(H,13,14)/b7-6+ |
| InChIKey | RCVGWZAQWMJQHG-VOTSOKGWSA-N |
| XLogP | 3.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|