C13H18O2 — CID 143530562
(E)-3-(2,7-dimethylspiro[2.5]oct-7-en-8-yl)prop-2-enoic acid (PubChem CID 143530562) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (E)-3-(2,7-dimethylspiro[2.5]oct-7-en-8-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(2,7-dimethylspiro[2.5]oct-7-en-8-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 143530562 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (E)-3-(2,7-dimethylspiro[2.5]oct-7-en-8-yl)prop-2-enoic acid |
| SMILES | CC1=C(/C=C/C(=O)O)C2(CCC1)CC2C |
| InChI | InChI=1S/C13H18O2/c1-9-4-3-7-13(8-10(13)2)11(9)5-6-12(14)15/h5-6,10H,3-4,7-8H2,1-2H3,(H,14,15)/b6-5+ |
| InChIKey | WMALBUTVHFJURG-AATRIKPKSA-N |
| XLogP | 3.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|