C18H22O2 — CID 101179373
(2Z,4E,8E)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,8-trien-6-ynoic acid (PubChem CID 101179373) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (2Z,4E,8E)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,8-trien-6-ynoic acid.
| Compound Name | (2Z,4E,8E)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,8-trien-6-ynoic acid |
|---|---|
| PubChem CID | 101179373 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (2Z,4E,8E)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,8-trien-6-ynoic acid |
| SMILES | CC1=C(/C=C/C#C/C=C/C=C\C(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C18H22O2/c1-15-11-10-14-18(2,3)16(15)12-8-6-4-5-7-9-13-17(19)20/h5,7-9,12-13H,10-11,14H2,1-3H3,(H,19,20)/b7-5+,12-8+,13-9- |
| InChIKey | NQXAXHNXDRSPGD-ADYOKBENSA-N |
| XLogP | 4.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|