C20H24O2S — CID 88523105
3-ethyl-5-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-1-ynyl]thiophene-2-carboxylic acid (PubChem CID 88523105) has the molecular formula C20H24O2S and a molecular weight of 328.48 g/mol. Its IUPAC name is 3-ethyl-5-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-1-ynyl]thiophene-2-carboxylic acid.
| Compound Name | 3-ethyl-5-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-1-ynyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 88523105 |
| Molecular Formula | C20H24O2S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 3-ethyl-5-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-1-ynyl]thiophene-2-carboxylic acid |
| SMILES | CCc1cc(C#C/C=C/C2=C(C)CCCC2(C)C)sc1C(=O)O |
| InChI | InChI=1S/C20H24O2S/c1-5-15-13-16(23-18(15)19(21)22)10-6-7-11-17-14(2)9-8-12-20(17,3)4/h7,11,13H,5,8-9,12H2,1-4H3,(H,21,22)/b11-7+ |
| InChIKey | XFNORBOBSBJDIV-YRNVUSSQSA-N |
| XLogP | 5.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|