C23H30O3 — CID 88604607
ethyl 4-[5-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-1-ynyl]furan-2-yl]butanoate (PubChem CID 88604607) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is ethyl 4-[5-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-1-ynyl]furan-2-yl]butanoate.
| Compound Name | ethyl 4-[5-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-1-ynyl]furan-2-yl]butanoate |
|---|---|
| PubChem CID | 88604607 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | ethyl 4-[5-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-1-ynyl]furan-2-yl]butanoate |
| SMILES | CCOC(=O)CCCc1ccc(C#CC=CC2=C(C)CCCC2(C)C)o1 |
| InChI | InChI=1S/C23H30O3/c1-5-25-22(24)14-8-12-20-16-15-19(26-20)11-6-7-13-21-18(2)10-9-17-23(21,3)4/h7,13,15-16H,5,8-10,12,14,17H2,1-4H3 |
| InChIKey | SOWHCAHTGYVZRY-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|