C26H32O4 — CID 22903963
ethyl 5-[5-[2-(2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]furan-2-yl]pentanoate (PubChem CID 22903963) has the molecular formula C26H32O4 and a molecular weight of 408.54 g/mol. Its IUPAC name is ethyl 5-[5-[2-(2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]furan-2-yl]pentanoate.
| Compound Name | ethyl 5-[5-[2-(2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]furan-2-yl]pentanoate |
|---|---|
| PubChem CID | 22903963 |
| Molecular Formula | C26H32O4 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | ethyl 5-[5-[2-(2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]furan-2-yl]pentanoate |
| SMILES | CCOC(=O)CCCCc1ccc(C#Cc2ccc3c(c2)C(C)(C)CC(C)(C)O3)o1 |
| InChI | InChI=1S/C26H32O4/c1-6-28-24(27)10-8-7-9-20-14-15-21(29-20)13-11-19-12-16-23-22(17-19)25(2,3)18-26(4,5)30-23/h12,14-17H,6-10,18H2,1-5H3 |
| InChIKey | DMSPIARWTQUIMF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|