C32H44N2O3S — CID 57071893
ethyl 5-[5-[2-(7-hexylsulfanyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate (PubChem CID 57071893) has the molecular formula C32H44N2O3S and a molecular weight of 536.78 g/mol. Its IUPAC name is ethyl 5-[5-[2-(7-hexylsulfanyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate.
| Compound Name | ethyl 5-[5-[2-(7-hexylsulfanyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate |
|---|---|
| PubChem CID | 57071893 |
| Molecular Formula | C32H44N2O3S |
| Molecular Weight | 536.78 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | ethyl 5-[5-[2-(7-hexylsulfanyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]pyrimidin-2-yl]pentanoate |
| SMILES | CCCCCCSc1cc2c(cc1C#Cc1cnc(CCCCC(=O)OCC)nc1)C(C)(C)CC(C)(C)O2 |
| InChI | InChI=1S/C32H44N2O3S/c1-7-9-10-13-18-38-28-20-27-26(31(3,4)23-32(5,6)37-27)19-25(28)17-16-24-21-33-29(34-22-24)14-11-12-15-30(35)36-8-2/h19-22H,7-15,18,23H2,1-6H3 |
| InChIKey | KRSXWIBTVZCJNR-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.78 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|