C31H41NO2S — CID 67903806
ethyl 5-[6-[2-(7-hexyl-4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]-3-pyridinyl]pentanoate (PubChem CID 67903806) has the molecular formula C31H41NO2S and a molecular weight of 491.74 g/mol. Its IUPAC name is ethyl 5-[6-[2-(7-hexyl-4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]-3-pyridinyl]pentanoate.
| Compound Name | ethyl 5-[6-[2-(7-hexyl-4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]-3-pyridinyl]pentanoate |
|---|---|
| PubChem CID | 67903806 |
| Molecular Formula | C31H41NO2S |
| Molecular Weight | 491.74 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | ethyl 5-[6-[2-(7-hexyl-4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]-3-pyridinyl]pentanoate |
| SMILES | CCCCCCc1cc2c(cc1C#Cc1ccc(CCCCC(=O)OCC)cn1)C(C)(C)CCS2 |
| InChI | InChI=1S/C31H41NO2S/c1-5-7-8-9-13-25-22-29-28(31(3,4)19-20-35-29)21-26(25)16-18-27-17-15-24(23-32-27)12-10-11-14-30(33)34-6-2/h15,17,21-23H,5-14,19-20H2,1-4H3 |
| InChIKey | CTFXNYDIHXILNR-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.74 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|