C26H31NO2S — CID 22903863
ethyl 6-[2-(2,2,4,4-tetramethyl-7-propyl-3H-thiochromen-6-yl)ethynyl]pyridine-3-carboxylate (PubChem CID 22903863) has the molecular formula C26H31NO2S and a molecular weight of 421.61 g/mol. Its IUPAC name is ethyl 6-[2-(2,2,4,4-tetramethyl-7-propyl-3H-thiochromen-6-yl)ethynyl]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[2-(2,2,4,4-tetramethyl-7-propyl-3H-thiochromen-6-yl)ethynyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 22903863 |
| Molecular Formula | C26H31NO2S |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | ethyl 6-[2-(2,2,4,4-tetramethyl-7-propyl-3H-thiochromen-6-yl)ethynyl]pyridine-3-carboxylate |
| SMILES | CCCc1cc2c(cc1C#Cc1ccc(C(=O)OCC)cn1)C(C)(C)CC(C)(C)S2 |
| InChI | InChI=1S/C26H31NO2S/c1-7-9-18-15-23-22(25(3,4)17-26(5,6)30-23)14-19(18)10-12-21-13-11-20(16-27-21)24(28)29-8-2/h11,13-16H,7-9,17H2,1-6H3 |
| InChIKey | QBCQJVVYKZWMLJ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|