C28H35NO2S — CID 67714767
2-[6-[2-(7-hexyl-2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]-3-pyridinyl]acetic acid (PubChem CID 67714767) has the molecular formula C28H35NO2S and a molecular weight of 449.66 g/mol. Its IUPAC name is 2-[6-[2-(7-hexyl-2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]-3-pyridinyl]acetic acid.
| Compound Name | 2-[6-[2-(7-hexyl-2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 67714767 |
| Molecular Formula | C28H35NO2S |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 2-[6-[2-(7-hexyl-2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]-3-pyridinyl]acetic acid |
| SMILES | CCCCCCc1cc2c(cc1C#Cc1ccc(CC(=O)O)cn1)C(C)(C)CC(C)(C)S2 |
| InChI | InChI=1S/C28H35NO2S/c1-6-7-8-9-10-21-17-25-24(27(2,3)19-28(4,5)32-25)16-22(21)12-14-23-13-11-20(18-29-23)15-26(30)31/h11,13,16-18H,6-10,15,19H2,1-5H3,(H,30,31) |
| InChIKey | FUWCLDNEQYXSJY-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|