C30H40O3S — CID 67939917
5-[5-[2-(7-hexyl-2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]furan-2-yl]pentanoic acid (PubChem CID 67939917) has the molecular formula C30H40O3S and a molecular weight of 480.71 g/mol. Its IUPAC name is 5-[5-[2-(7-hexyl-2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]furan-2-yl]pentanoic acid.
| Compound Name | 5-[5-[2-(7-hexyl-2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]furan-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 67939917 |
| Molecular Formula | C30H40O3S |
| Molecular Weight | 480.71 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 5-[5-[2-(7-hexyl-2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]furan-2-yl]pentanoic acid |
| SMILES | CCCCCCc1cc2c(cc1C#Cc1ccc(CCCCC(=O)O)o1)C(C)(C)CC(C)(C)S2 |
| InChI | InChI=1S/C30H40O3S/c1-6-7-8-9-12-22-20-27-26(29(2,3)21-30(4,5)34-27)19-23(22)15-16-25-18-17-24(33-25)13-10-11-14-28(31)32/h17-20H,6-14,21H2,1-5H3,(H,31,32) |
| InChIKey | NSJCKAIQDBGCOU-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.71 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|