C27H33N2O3- — CID 22903919
2-[5-[2-(7-hexyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]pyrimidin-2-yl]acetate (PubChem CID 22903919) has the molecular formula C27H33N2O3- and a molecular weight of 433.57 g/mol. Its IUPAC name is 2-[5-[2-(7-hexyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]pyrimidin-2-yl]acetate.
| Compound Name | 2-[5-[2-(7-hexyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]pyrimidin-2-yl]acetate |
|---|---|
| PubChem CID | 22903919 |
| Molecular Formula | C27H33N2O3- |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 2-[5-[2-(7-hexyl-2,2,4,4-tetramethyl-3H-chromen-6-yl)ethynyl]pyrimidin-2-yl]acetate |
| SMILES | CCCCCCc1cc2c(cc1C#Cc1cnc(CC(=O)[O-])nc1)C(C)(C)CC(C)(C)O2 |
| InChI | InChI=1S/C27H34N2O3/c1-6-7-8-9-10-20-14-23-22(26(2,3)18-27(4,5)32-23)13-21(20)12-11-19-16-28-24(29-17-19)15-25(30)31/h13-14,16-17H,6-10,15,18H2,1-5H3,(H,30,31)/p-1 |
| InChIKey | KGHAYRGZHQJCAI-UHFFFAOYSA-M |
| XLogP | 4.13 |
| TPSA | 75.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|