C27H35O2- — CID 23002519
(2E,4E)-3-methyl-7-(5,5,8,8-tetramethyl-3-pentyl-6,7-dihydronaphthalen-2-yl)hepta-2,4-dien-6-ynoate (PubChem CID 23002519) has the molecular formula C27H35O2- and a molecular weight of 391.58 g/mol. Its IUPAC name is (2E,4E)-3-methyl-7-(5,5,8,8-tetramethyl-3-pentyl-6,7-dihydronaphthalen-2-yl)hepta-2,4-dien-6-ynoate.
| Compound Name | (2E,4E)-3-methyl-7-(5,5,8,8-tetramethyl-3-pentyl-6,7-dihydronaphthalen-2-yl)hepta-2,4-dien-6-ynoate |
|---|---|
| PubChem CID | 23002519 |
| Molecular Formula | C27H35O2- |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | (2E,4E)-3-methyl-7-(5,5,8,8-tetramethyl-3-pentyl-6,7-dihydronaphthalen-2-yl)hepta-2,4-dien-6-ynoate |
| SMILES | CCCCCc1cc2c(cc1C#C/C=C/C(C)=C/C(=O)[O-])C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C27H36O2/c1-7-8-9-13-21-18-23-24(27(5,6)16-15-26(23,3)4)19-22(21)14-11-10-12-20(2)17-25(28)29/h10,12,17-19H,7-9,13,15-16H2,1-6H3,(H,28,29)/p-1/b12-10+,20-17+ |
| InChIKey | MWIHYGQTNBUROK-IYGGMARFSA-M |
| XLogP | 5.37 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|