C20H30O — CID 23002510
5,5,8,8-tetramethyl-3-pentyl-6,7-dihydronaphthalene-2-carbaldehyde (PubChem CID 23002510) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is 5,5,8,8-tetramethyl-3-pentyl-6,7-dihydronaphthalene-2-carbaldehyde.
| Compound Name | 5,5,8,8-tetramethyl-3-pentyl-6,7-dihydronaphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 23002510 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 5,5,8,8-tetramethyl-3-pentyl-6,7-dihydronaphthalene-2-carbaldehyde |
| SMILES | CCCCCc1cc2c(cc1C=O)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C20H30O/c1-6-7-8-9-15-12-17-18(13-16(15)14-21)20(4,5)11-10-19(17,2)3/h12-14H,6-11H2,1-5H3 |
| InChIKey | YMXSGXFMGRUESZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|