C21H33Br — CID 22456869
6-(bromomethyl)-7-hexyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (PubChem CID 22456869) has the molecular formula C21H33Br and a molecular weight of 365.40 g/mol. Its IUPAC name is 6-(bromomethyl)-7-hexyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene.
| Compound Name | 6-(bromomethyl)-7-hexyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 22456869 |
| Molecular Formula | C21H33Br |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 6-(bromomethyl)-7-hexyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
| SMILES | CCCCCCc1cc2c(cc1CBr)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C21H33Br/c1-6-7-8-9-10-16-13-18-19(14-17(16)15-22)21(4,5)12-11-20(18,2)3/h13-14H,6-12,15H2,1-5H3 |
| InChIKey | DISRQZLDWRMHAZ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|