C22H36OS — CID 139626404
1-(5,5-dimethyl-8-octyl-3,4-dihydro-2H-1-benzothiepin-7-yl)ethanol (PubChem CID 139626404) has the molecular formula C22H36OS and a molecular weight of 348.60 g/mol. Its IUPAC name is 1-(5,5-dimethyl-8-octyl-3,4-dihydro-2H-1-benzothiepin-7-yl)ethanol.
| Compound Name | 1-(5,5-dimethyl-8-octyl-3,4-dihydro-2H-1-benzothiepin-7-yl)ethanol |
|---|---|
| PubChem CID | 139626404 |
| Molecular Formula | C22H36OS |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 1-(5,5-dimethyl-8-octyl-3,4-dihydro-2H-1-benzothiepin-7-yl)ethanol |
| SMILES | CCCCCCCCc1cc2c(cc1C(C)O)C(C)(C)CCCS2 |
| InChI | InChI=1S/C22H36OS/c1-5-6-7-8-9-10-12-18-15-21-20(16-19(18)17(2)23)22(3,4)13-11-14-24-21/h15-17,23H,5-14H2,1-4H3 |
| InChIKey | YVJWTLSCAFEMBQ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|