C18H28OS — CID 129388058
(2R)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)heptan-1-ol (PubChem CID 129388058) has the molecular formula C18H28OS and a molecular weight of 292.49 g/mol. Its IUPAC name is (2R)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)heptan-1-ol.
| Compound Name | (2R)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)heptan-1-ol |
|---|---|
| PubChem CID | 129388058 |
| Molecular Formula | C18H28OS |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (2R)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)heptan-1-ol |
| SMILES | CCCCC[C@@H](CO)c1ccc2c(c1)C(C)(C)CCS2 |
| InChI | InChI=1S/C18H28OS/c1-4-5-6-7-15(13-19)14-8-9-17-16(12-14)18(2,3)10-11-20-17/h8-9,12,15,19H,4-7,10-11,13H2,1-3H3/t15-/m0/s1 |
| InChIKey | NSQKUCSPILSRPB-HNNXBMFYSA-N |
| XLogP | 5.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|