C13H18OS — CID 116964166
2-(3,4-dihydro-2H-thiochromen-6-yl)butan-1-ol (PubChem CID 116964166) has the molecular formula C13H18OS and a molecular weight of 222.35 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-thiochromen-6-yl)butan-1-ol.
| Compound Name | 2-(3,4-dihydro-2H-thiochromen-6-yl)butan-1-ol |
|---|---|
| PubChem CID | 116964166 |
| Molecular Formula | C13H18OS |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 2-(3,4-dihydro-2H-thiochromen-6-yl)butan-1-ol |
| SMILES | CCC(CO)c1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C13H18OS/c1-2-10(9-14)11-5-6-13-12(8-11)4-3-7-15-13/h5-6,8,10,14H,2-4,7,9H2,1H3 |
| InChIKey | NSGFMSCGZALFEA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |