C12H18N2OS — CID 116942431
2,3-diamino-3-(3,4-dihydro-2H-thiochromen-6-yl)propan-1-ol (PubChem CID 116942431) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 2,3-diamino-3-(3,4-dihydro-2H-thiochromen-6-yl)propan-1-ol.
| Compound Name | 2,3-diamino-3-(3,4-dihydro-2H-thiochromen-6-yl)propan-1-ol |
|---|---|
| PubChem CID | 116942431 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2,3-diamino-3-(3,4-dihydro-2H-thiochromen-6-yl)propan-1-ol |
| SMILES | NC(CO)C(N)c1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C12H18N2OS/c13-10(7-15)12(14)9-3-4-11-8(6-9)2-1-5-16-11/h3-4,6,10,12,15H,1-2,5,7,13-14H2 |
| InChIKey | SYIFSXDDTXYDDB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |