C12H14O3S — CID 116862954
2-hydroxyethyl 3,4-dihydro-2H-thiochromene-6-carboxylate (PubChem CID 116862954) has the molecular formula C12H14O3S and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-hydroxyethyl 3,4-dihydro-2H-thiochromene-6-carboxylate.
| Compound Name | 2-hydroxyethyl 3,4-dihydro-2H-thiochromene-6-carboxylate |
|---|---|
| PubChem CID | 116862954 |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 2-hydroxyethyl 3,4-dihydro-2H-thiochromene-6-carboxylate |
| SMILES | O=C(OCCO)c1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C12H14O3S/c13-5-6-15-12(14)10-3-4-11-9(8-10)2-1-7-16-11/h3-4,8,13H,1-2,5-7H2 |
| InChIKey | ZDJWXMDVCSFBQZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |