C15H19NOS — CID 116916957
3,4-dihydro-2H-thiochromen-6-yl(piperidin-4-yl)methanone (PubChem CID 116916957) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is 3,4-dihydro-2H-thiochromen-6-yl(piperidin-4-yl)methanone.
| Compound Name | 3,4-dihydro-2H-thiochromen-6-yl(piperidin-4-yl)methanone |
|---|---|
| PubChem CID | 116916957 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 3,4-dihydro-2H-thiochromen-6-yl(piperidin-4-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)CCCS2)C1CCNCC1 |
| InChI | InChI=1S/C15H19NOS/c17-15(11-5-7-16-8-6-11)13-3-4-14-12(10-13)2-1-9-18-14/h3-4,10-11,16H,1-2,5-9H2 |
| InChIKey | DWCKEFRXRFWXOA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |