C22H27N3O2S2 — CID 162521599
1-piperazin-1-ylethanone;N-(4-sulfanylphenyl)-3,4-dihydro-2H-thiochromene-6-carboxamide (PubChem CID 162521599) has the molecular formula C22H27N3O2S2 and a molecular weight of 429.61 g/mol. Its IUPAC name is 1-piperazin-1-ylethanone;N-(4-sulfanylphenyl)-3,4-dihydro-2H-thiochromene-6-carboxamide.
| Compound Name | 1-piperazin-1-ylethanone;N-(4-sulfanylphenyl)-3,4-dihydro-2H-thiochromene-6-carboxamide |
|---|---|
| PubChem CID | 162521599 |
| Molecular Formula | C22H27N3O2S2 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 1-piperazin-1-ylethanone;N-(4-sulfanylphenyl)-3,4-dihydro-2H-thiochromene-6-carboxamide |
| SMILES | CC(=O)N1CCNCC1.O=C(Nc1ccc(S)cc1)c1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C16H15NOS2.C6H12N2O/c18-16(17-13-4-6-14(19)7-5-13)12-3-8-15-11(10-12)2-1-9-20-15;1-6(9)8-4-2-7-3-5-8/h3-8,10,19H,1-2,9H2,(H,17,18);7H,2-5H2,1H3 |
| InChIKey | OSHHOLWGNYXDHY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|