C10H9ClOS — CID 54051226
3,4-dihydro-2H-thiochromene-6-carbonyl chloride (PubChem CID 54051226) has the molecular formula C10H9ClOS and a molecular weight of 212.70 g/mol. Its IUPAC name is 3,4-dihydro-2H-thiochromene-6-carbonyl chloride.
| Compound Name | 3,4-dihydro-2H-thiochromene-6-carbonyl chloride |
|---|---|
| PubChem CID | 54051226 |
| Molecular Formula | C10H9ClOS |
| Molecular Weight | 212.70 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | 3,4-dihydro-2H-thiochromene-6-carbonyl chloride |
| SMILES | O=C(Cl)c1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C10H9ClOS/c11-10(12)8-3-4-9-7(6-8)2-1-5-13-9/h3-4,6H,1-2,5H2 |
| InChIKey | LSZPUHNYHXUSQK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.70 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|