C12H14ClNOS — CID 115161946
2-chloro-N-(3,4-dihydro-2H-thiochromen-6-yl)-N-methylacetamide (PubChem CID 115161946) has the molecular formula C12H14ClNOS and a molecular weight of 255.77 g/mol. Its IUPAC name is 2-chloro-N-(3,4-dihydro-2H-thiochromen-6-yl)-N-methylacetamide.
| Compound Name | 2-chloro-N-(3,4-dihydro-2H-thiochromen-6-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 115161946 |
| Molecular Formula | C12H14ClNOS |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 2-chloro-N-(3,4-dihydro-2H-thiochromen-6-yl)-N-methylacetamide |
| SMILES | CN(C(=O)CCl)c1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C12H14ClNOS/c1-14(12(15)8-13)10-4-5-11-9(7-10)3-2-6-16-11/h4-5,7H,2-3,6,8H2,1H3 |
| InChIKey | UCAVZNRUQKPMHA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|