C12H17NS2 — CID 115223862
2-[3,4-dihydro-2H-thiochromen-6-yl(methyl)amino]ethanethiol (PubChem CID 115223862) has the molecular formula C12H17NS2 and a molecular weight of 239.41 g/mol. Its IUPAC name is 2-[3,4-dihydro-2H-thiochromen-6-yl(methyl)amino]ethanethiol.
| Compound Name | 2-[3,4-dihydro-2H-thiochromen-6-yl(methyl)amino]ethanethiol |
|---|---|
| PubChem CID | 115223862 |
| Molecular Formula | C12H17NS2 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-[3,4-dihydro-2H-thiochromen-6-yl(methyl)amino]ethanethiol |
| SMILES | CN(CCS)c1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C12H17NS2/c1-13(6-7-14)11-4-5-12-10(9-11)3-2-8-15-12/h4-5,9,14H,2-3,6-8H2,1H3 |
| InChIKey | UDQKLHLHYQDOFV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|