C13H19NS — CID 115224698
3-[2,3-dihydro-1H-inden-5-yl(methyl)amino]propane-1-thiol (PubChem CID 115224698) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is 3-[2,3-dihydro-1H-inden-5-yl(methyl)amino]propane-1-thiol.
| Compound Name | 3-[2,3-dihydro-1H-inden-5-yl(methyl)amino]propane-1-thiol |
|---|---|
| PubChem CID | 115224698 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3-[2,3-dihydro-1H-inden-5-yl(methyl)amino]propane-1-thiol |
| SMILES | CN(CCCS)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H19NS/c1-14(8-3-9-15)13-7-6-11-4-2-5-12(11)10-13/h6-7,10,15H,2-5,8-9H2,1H3 |
| InChIKey | AMIYYJCPXUGYHL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|