C12H17NO — CID 115258329
N-(methoxymethyl)-N-methyl-2,3-dihydro-1H-inden-5-amine (PubChem CID 115258329) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is N-(methoxymethyl)-N-methyl-2,3-dihydro-1H-inden-5-amine.
| Compound Name | N-(methoxymethyl)-N-methyl-2,3-dihydro-1H-inden-5-amine |
|---|---|
| PubChem CID | 115258329 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N-(methoxymethyl)-N-methyl-2,3-dihydro-1H-inden-5-amine |
| SMILES | COCN(C)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C12H17NO/c1-13(9-14-2)12-7-6-10-4-3-5-11(10)8-12/h6-8H,3-5,9H2,1-2H3 |
| InChIKey | TXZAUWNXUOOTSR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|