C19H24N2 — CID 144987164
1-N,1-N,4-N-trimethyl-4-N-(5,6,7,8-tetrahydronaphthalen-2-yl)benzene-1,4-diamine (PubChem CID 144987164) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 1-N,1-N,4-N-trimethyl-4-N-(5,6,7,8-tetrahydronaphthalen-2-yl)benzene-1,4-diamine.
| Compound Name | 1-N,1-N,4-N-trimethyl-4-N-(5,6,7,8-tetrahydronaphthalen-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 144987164 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1-N,1-N,4-N-trimethyl-4-N-(5,6,7,8-tetrahydronaphthalen-2-yl)benzene-1,4-diamine |
| SMILES | CN(C)c1ccc(N(C)c2ccc3c(c2)CCCC3)cc1 |
| InChI | InChI=1S/C19H24N2/c1-20(2)17-10-12-18(13-11-17)21(3)19-9-8-15-6-4-5-7-16(15)14-19/h8-14H,4-7H2,1-3H3 |
| InChIKey | BVTFHWGYFULOOC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|