C28H38N4O2 — CID 144987163
ethane;3-(methylamino)pyridine-4-carboxylic acid;1-N,1-N,4-N-trimethyl-4-N-(5,6,7,8-tetrahydronaphthalen-2-yl)benzene-1,4-diamine (PubChem CID 144987163) has the molecular formula C28H38N4O2 and a molecular weight of 462.64 g/mol. Its IUPAC name is ethane;3-(methylamino)pyridine-4-carboxylic acid;1-N,1-N,4-N-trimethyl-4-N-(5,6,7,8-tetrahydronaphthalen-2-yl)benzene-1,4-diamine.
| Compound Name | ethane;3-(methylamino)pyridine-4-carboxylic acid;1-N,1-N,4-N-trimethyl-4-N-(5,6,7,8-tetrahydronaphthalen-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 144987163 |
| Molecular Formula | C28H38N4O2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | ethane;3-(methylamino)pyridine-4-carboxylic acid;1-N,1-N,4-N-trimethyl-4-N-(5,6,7,8-tetrahydronaphthalen-2-yl)benzene-1,4-diamine |
| SMILES | CC.CN(C)c1ccc(N(C)c2ccc3c(c2)CCCC3)cc1.CNc1cnccc1C(=O)O |
| InChI | InChI=1S/C19H24N2.C7H8N2O2.C2H6/c1-20(2)17-10-12-18(13-11-17)21(3)19-9-8-15-6-4-5-7-16(15)14-19;1-8-6-4-9-3-2-5(6)7(10)11;1-2/h8-14H,4-7H2,1-3H3;2-4,8H,1H3,(H,10,11);1-2H3 |
| InChIKey | HAYFLBXGDAQYGM-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|