C13H19NO — CID 115258314
N-(methoxymethyl)-N-methyl-5,6,7,8-tetrahydronaphthalen-2-amine (PubChem CID 115258314) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is N-(methoxymethyl)-N-methyl-5,6,7,8-tetrahydronaphthalen-2-amine.
| Compound Name | N-(methoxymethyl)-N-methyl-5,6,7,8-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 115258314 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | N-(methoxymethyl)-N-methyl-5,6,7,8-tetrahydronaphthalen-2-amine |
| SMILES | COCN(C)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C13H19NO/c1-14(10-15-2)13-8-7-11-5-3-4-6-12(11)9-13/h7-9H,3-6,10H2,1-2H3 |
| InChIKey | JPKKBVBDHMJCIA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|