C13H16N2 — CID 115230731
3-[2,3-dihydro-1H-inden-5-yl(methyl)amino]propanenitrile (PubChem CID 115230731) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 3-[2,3-dihydro-1H-inden-5-yl(methyl)amino]propanenitrile.
| Compound Name | 3-[2,3-dihydro-1H-inden-5-yl(methyl)amino]propanenitrile |
|---|---|
| PubChem CID | 115230731 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 3-[2,3-dihydro-1H-inden-5-yl(methyl)amino]propanenitrile |
| SMILES | CN(CCC#N)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H16N2/c1-15(9-3-8-14)13-7-6-11-4-2-5-12(11)10-13/h6-7,10H,2-5,9H2,1H3 |
| InChIKey | FOKYKCNQOWPEKF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|