methyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate

C15H21NO2 — CID 115233351

IUPACmethyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate
SMILESCOC(=O)CCCN(C)c1ccc2c(c1)CCC2
InChIInChI=1S/C15H21NO2/c1-16(10-4-7-15(17)18-2)14-9-8-12-5-3-6-13(12)11-14/h8-9,11H,3-7,10H2,1-2H3
InChIKeyWMBIYOFMWLILNB-UHFFFAOYSA-N
MW247.34 g/mol
LogP2.56
Rot. Bonds5

About methyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate

methyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate (PubChem CID 115233351) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is methyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate.

Molecular Properties

Compound Namemethyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate
PubChem CID115233351
Molecular FormulaC15H21NO2
Molecular Weight247.34 g/mol
Exact Mass247.16
IUPAC Namemethyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate
SMILESCOC(=O)CCCN(C)c1ccc2c(c1)CCC2
InChIInChI=1S/C15H21NO2/c1-16(10-4-7-15(17)18-2)14-9-8-12-5-3-6-13(12)11-14/h8-9,11H,3-7,10H2,1-2H3
InChIKeyWMBIYOFMWLILNB-UHFFFAOYSA-N
XLogP2.56
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.34
LogP ≤ 52.56
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}

Analyze methyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate?
The IUPAC name of methyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate (CID 115233351) is methyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate.
What is the SMILES notation for methyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate?
The canonical SMILES for methyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate is COC(=O)CCCN(C)c1ccc2c(c1)CCC2.
What is the InChIKey of methyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate?
The InChIKey is WMBIYOFMWLILNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c1-16(10-4-7-15(17)18-2)14-9-8-12-5-3-6-13(12)11-14/h8-9,11H,3-7,10H2,1-2H3.
What are the key properties of methyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate?
methyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate has a molecular weight of 247.34 g/mol, XLogP of 2.56, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate is sourced from PubChem (CID 115233351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).