C15H21NO2 — CID 115233351
methyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate (PubChem CID 115233351) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is methyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate.
| Compound Name | methyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate |
|---|---|
| PubChem CID | 115233351 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | methyl 4-[2,3-dihydro-1H-inden-5-yl(methyl)amino]butanoate |
| SMILES | COC(=O)CCCN(C)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H21NO2/c1-16(10-4-7-15(17)18-2)14-9-8-12-5-3-6-13(12)11-14/h8-9,11H,3-7,10H2,1-2H3 |
| InChIKey | WMBIYOFMWLILNB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|