C13H19NS2 — CID 115228465
[2-(3,4-dihydro-2H-thiochromen-6-yl)ethyl-methylamino]methanethiol (PubChem CID 115228465) has the molecular formula C13H19NS2 and a molecular weight of 253.44 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-thiochromen-6-yl)ethyl-methylamino]methanethiol.
| Compound Name | [2-(3,4-dihydro-2H-thiochromen-6-yl)ethyl-methylamino]methanethiol |
|---|---|
| PubChem CID | 115228465 |
| Molecular Formula | C13H19NS2 |
| Molecular Weight | 253.44 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | [2-(3,4-dihydro-2H-thiochromen-6-yl)ethyl-methylamino]methanethiol |
| SMILES | CN(CS)CCc1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C13H19NS2/c1-14(10-15)7-6-11-4-5-13-12(9-11)3-2-8-16-13/h4-5,9,15H,2-3,6-8,10H2,1H3 |
| InChIKey | NPZQSXWWDJFNOF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|