C23H21ClN2OS2 — CID 162521463
N-[4-(4-chloro-N-methylanilino)sulfanylphenyl]-3,4-dihydro-2H-thiochromene-6-carboxamide (PubChem CID 162521463) has the molecular formula C23H21ClN2OS2 and a molecular weight of 441.02 g/mol. Its IUPAC name is N-[4-(4-chloro-N-methylanilino)sulfanylphenyl]-3,4-dihydro-2H-thiochromene-6-carboxamide.
| Compound Name | N-[4-(4-chloro-N-methylanilino)sulfanylphenyl]-3,4-dihydro-2H-thiochromene-6-carboxamide |
|---|---|
| PubChem CID | 162521463 |
| Molecular Formula | C23H21ClN2OS2 |
| Molecular Weight | 441.02 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | N-[4-(4-chloro-N-methylanilino)sulfanylphenyl]-3,4-dihydro-2H-thiochromene-6-carboxamide |
| SMILES | CN(Sc1ccc(NC(=O)c2ccc3c(c2)CCCS3)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H21ClN2OS2/c1-26(20-9-5-18(24)6-10-20)29-21-11-7-19(8-12-21)25-23(27)17-4-13-22-16(15-17)3-2-14-28-22/h4-13,15H,2-3,14H2,1H3,(H,25,27) |
| InChIKey | BHYVVNCTSMKMGM-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.02 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|