C18H17NO3 — CID 18876241
4-(5,6,7,8-tetrahydronaphthalene-2-carbonylamino)benzoic acid (PubChem CID 18876241) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 4-(5,6,7,8-tetrahydronaphthalene-2-carbonylamino)benzoic acid.
| Compound Name | 4-(5,6,7,8-tetrahydronaphthalene-2-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 18876241 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 4-(5,6,7,8-tetrahydronaphthalene-2-carbonylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2ccc3c(c2)CCCC3)cc1 |
| InChI | InChI=1S/C18H17NO3/c20-17(19-16-9-7-13(8-10-16)18(21)22)15-6-5-12-3-1-2-4-14(12)11-15/h5-11H,1-4H2,(H,19,20)(H,21,22) |
| InChIKey | YBLHTMVOCZPGFD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |