C27H31NO — CID 100703536
N-[4-(1-adamantyl)phenyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 100703536) has the molecular formula C27H31NO and a molecular weight of 385.55 g/mol. Its IUPAC name is N-[4-(1-adamantyl)phenyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-[4-(1-adamantyl)phenyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 100703536 |
| Molecular Formula | C27H31NO |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | N-[4-(1-adamantyl)phenyl]-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | O=C(Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C27H31NO/c29-26(23-6-5-21-3-1-2-4-22(21)14-23)28-25-9-7-24(8-10-25)27-15-18-11-19(16-27)13-20(12-18)17-27/h5-10,14,18-20H,1-4,11-13,15-17H2,(H,28,29) |
| InChIKey | CXDZRQRRUADVCR-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |