C30H38N2O — CID 38106623
N-[4-(1-adamantyl)phenyl]-4-[(4-methylpiperidin-1-yl)methyl]benzamide (PubChem CID 38106623) has the molecular formula C30H38N2O and a molecular weight of 442.65 g/mol. Its IUPAC name is N-[4-(1-adamantyl)phenyl]-4-[(4-methylpiperidin-1-yl)methyl]benzamide.
| Compound Name | N-[4-(1-adamantyl)phenyl]-4-[(4-methylpiperidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 38106623 |
| Molecular Formula | C30H38N2O |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | N-[4-(1-adamantyl)phenyl]-4-[(4-methylpiperidin-1-yl)methyl]benzamide |
| SMILES | CC1CCN(Cc2ccc(C(=O)Nc3ccc(C45CC6CC(CC(C6)C4)C5)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H38N2O/c1-21-10-12-32(13-11-21)20-22-2-4-26(5-3-22)29(33)31-28-8-6-27(7-9-28)30-17-23-14-24(18-30)16-25(15-23)19-30/h2-9,21,23-25H,10-20H2,1H3,(H,31,33) |
| InChIKey | FTOOAQJNBBDOGE-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |