C29H29NO — CID 98144092
N-[4-[(5R,7R)-3-phenyl-1-adamantyl]phenyl]benzamide (PubChem CID 98144092) has the molecular formula C29H29NO and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[4-[(5R,7R)-3-phenyl-1-adamantyl]phenyl]benzamide.
| Compound Name | N-[4-[(5R,7R)-3-phenyl-1-adamantyl]phenyl]benzamide |
|---|---|
| PubChem CID | 98144092 |
| Molecular Formula | C29H29NO |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | N-[4-[(5R,7R)-3-phenyl-1-adamantyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C23C[C@@H]4C[C@H](CC(c5ccccc5)(C4)C2)C3)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H29NO/c31-27(23-7-3-1-4-8-23)30-26-13-11-25(12-14-26)29-18-21-15-22(19-29)17-28(16-21,20-29)24-9-5-2-6-10-24/h1-14,21-22H,15-20H2,(H,30,31)/t21-,22-,28?,29?/m1/s1 |
| InChIKey | YQTWEVXDOHZBKW-RGHCOQMCSA-N |
| XLogP | 6.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |