C23H26N2O3S — CID 98586974
(5S,7S)-3-phenyl-N-(4-sulfamoylphenyl)adamantane-1-carboxamide (PubChem CID 98586974) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is (5S,7S)-3-phenyl-N-(4-sulfamoylphenyl)adamantane-1-carboxamide.
| Compound Name | (5S,7S)-3-phenyl-N-(4-sulfamoylphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98586974 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (5S,7S)-3-phenyl-N-(4-sulfamoylphenyl)adamantane-1-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C23C[C@H]4C[C@H](C2)CC(c2ccccc2)(C4)C3)cc1 |
| InChI | InChI=1S/C23H26N2O3S/c24-29(27,28)20-8-6-19(7-9-20)25-21(26)23-13-16-10-17(14-23)12-22(11-16,15-23)18-4-2-1-3-5-18/h1-9,16-17H,10-15H2,(H,25,26)(H2,24,27,28)/t16-,17-,22?,23?/m0/s1 |
| InChIKey | RIVJULWDAMQWTF-PQJGELLGSA-N |
| XLogP | 3.81 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |