C25H24N2O3 — CID 3547082
N-(1,3-dioxoisoindol-4-yl)-3-phenyladamantane-1-carboxamide (PubChem CID 3547082) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-4-yl)-3-phenyladamantane-1-carboxamide.
| Compound Name | N-(1,3-dioxoisoindol-4-yl)-3-phenyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 3547082 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-(1,3-dioxoisoindol-4-yl)-3-phenyladamantane-1-carboxamide |
| SMILES | O=C1NC(=O)c2c(NC(=O)C34CC5CC(C3)CC(c3ccccc3)(C5)C4)cccc21 |
| InChI | InChI=1S/C25H24N2O3/c28-21-18-7-4-8-19(20(18)22(29)27-21)26-23(30)25-12-15-9-16(13-25)11-24(10-15,14-25)17-5-2-1-3-6-17/h1-8,15-16H,9-14H2,(H,26,30)(H,27,28,29) |
| InChIKey | SGZWTSFXCKEQJK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|