C23H31NO — CID 52510423
azepan-1-yl-[(5S,7R)-3-phenyl-1-adamantyl]methanone (PubChem CID 52510423) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is azepan-1-yl-[(5S,7R)-3-phenyl-1-adamantyl]methanone.
| Compound Name | azepan-1-yl-[(5S,7R)-3-phenyl-1-adamantyl]methanone |
|---|---|
| PubChem CID | 52510423 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | azepan-1-yl-[(5S,7R)-3-phenyl-1-adamantyl]methanone |
| SMILES | O=C(N1CCCCCC1)C12C[C@H]3C[C@@H](C1)CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C23H31NO/c25-21(24-10-6-1-2-7-11-24)23-15-18-12-19(16-23)14-22(13-18,17-23)20-8-4-3-5-9-20/h3-5,8-9,18-19H,1-2,6-7,10-17H2/t18-,19+,22?,23? |
| InChIKey | PZZMTVZQDXOCJS-MGAZVUHYSA-N |
| XLogP | 4.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |