C23H32NO+ — CID 7471204
1-[(5S,7R)-3-phenyl-1-adamantyl]-2-piperidin-1-ium-1-ylethanone (PubChem CID 7471204) has the molecular formula C23H32NO+ and a molecular weight of 338.52 g/mol. Its IUPAC name is 1-[(5S,7R)-3-phenyl-1-adamantyl]-2-piperidin-1-ium-1-ylethanone.
| Compound Name | 1-[(5S,7R)-3-phenyl-1-adamantyl]-2-piperidin-1-ium-1-ylethanone |
|---|---|
| PubChem CID | 7471204 |
| Molecular Formula | C23H32NO+ |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 1-[(5S,7R)-3-phenyl-1-adamantyl]-2-piperidin-1-ium-1-ylethanone |
| SMILES | O=C(C[NH+]1CCCCC1)C12C[C@H]3C[C@@H](C1)CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C23H31NO/c25-21(16-24-9-5-2-6-10-24)23-14-18-11-19(15-23)13-22(12-18,17-23)20-7-3-1-4-8-20/h1,3-4,7-8,18-19H,2,5-6,9-17H2/p+1/t18-,19+,22?,23? |
| InChIKey | OKUDWNOUPOGCKG-MGAZVUHYSA-O |
| XLogP | 3.16 |
| TPSA | 21.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |