C22H29NO2 — CID 98161318
2-morpholin-4-yl-1-[(5S,7S)-3-phenyl-1-adamantyl]ethanone (PubChem CID 98161318) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-morpholin-4-yl-1-[(5S,7S)-3-phenyl-1-adamantyl]ethanone.
| Compound Name | 2-morpholin-4-yl-1-[(5S,7S)-3-phenyl-1-adamantyl]ethanone |
|---|---|
| PubChem CID | 98161318 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 2-morpholin-4-yl-1-[(5S,7S)-3-phenyl-1-adamantyl]ethanone |
| SMILES | O=C(CN1CCOCC1)C12C[C@H]3C[C@H](C1)CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C22H29NO2/c24-20(15-23-6-8-25-9-7-23)22-13-17-10-18(14-22)12-21(11-17,16-22)19-4-2-1-3-5-19/h1-5,17-18H,6-16H2/t17-,18-,21?,22?/m0/s1 |
| InChIKey | IUISOIYTZCQMGT-HTAFUYNTSA-N |
| XLogP | 3.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |