C31H39NO3 — CID 158904841
4-(4-methoxyphenyl)-4-morpholin-4-yl-1-(3-phenyl-1-adamantyl)butan-1-one (PubChem CID 158904841) has the molecular formula C31H39NO3 and a molecular weight of 473.66 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-4-morpholin-4-yl-1-(3-phenyl-1-adamantyl)butan-1-one.
| Compound Name | 4-(4-methoxyphenyl)-4-morpholin-4-yl-1-(3-phenyl-1-adamantyl)butan-1-one |
|---|---|
| PubChem CID | 158904841 |
| Molecular Formula | C31H39NO3 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | 4-(4-methoxyphenyl)-4-morpholin-4-yl-1-(3-phenyl-1-adamantyl)butan-1-one |
| SMILES | COc1ccc(C(CCC(=O)C23CC4CC(C2)CC(c2ccccc2)(C4)C3)N2CCOCC2)cc1 |
| InChI | InChI=1S/C31H39NO3/c1-34-27-9-7-25(8-10-27)28(32-13-15-35-16-14-32)11-12-29(33)31-20-23-17-24(21-31)19-30(18-23,22-31)26-5-3-2-4-6-26/h2-10,23-24,28H,11-22H2,1H3 |
| InChIKey | RSXSSERFAADIBG-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |